C28H36O10 — CID 5099214
(2,11,16-triacetyloxy-9-formyl-5,5-dimethyl-14-methylidene-15-oxo-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl) acetate (PubChem CID 5099214) has the molecular formula C28H36O10 and a molecular weight of 532.59 g/mol. Its IUPAC name is (2,11,16-triacetyloxy-9-formyl-5,5-dimethyl-14-methylidene-15-oxo-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl) acetate.
| Compound Name | (2,11,16-triacetyloxy-9-formyl-5,5-dimethyl-14-methylidene-15-oxo-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl) acetate |
|---|---|
| PubChem CID | 5099214 |
| Molecular Formula | C28H36O10 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | (2,11,16-triacetyloxy-9-formyl-5,5-dimethyl-14-methylidene-15-oxo-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl) acetate |
| SMILES | C=C1C(=O)C23C(OC(C)=O)CC4C(C)(C)CCC(OC(C)=O)C4(C=O)C2C(OC(C)=O)CC1C3OC(C)=O |
| InChI | InChI=1S/C28H36O10/c1-13-18-10-19(35-14(2)30)23-27(12-29)20(26(6,7)9-8-21(27)36-15(3)31)11-22(37-16(4)32)28(23,24(13)34)25(18)38-17(5)33/h12,18-23,25H,1,8-11H2,2-7H3 |
| InChIKey | PYYXKWSPHKCMGX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|