C30H40O11 — CID 95242394
[(1R,2R,4R,8R,9R,10R,11S,13R,16S)-2,11,13,16-tetraacetyloxy-5,5,9-trimethyl-14-methylidene-15-oxo-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate (PubChem CID 95242394) has the molecular formula C30H40O11 and a molecular weight of 576.64 g/mol. Its IUPAC name is [(1R,2R,4R,8R,9R,10R,11S,13R,16S)-2,11,13,16-tetraacetyloxy-5,5,9-trimethyl-14-methylidene-15-oxo-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate.
| Compound Name | [(1R,2R,4R,8R,9R,10R,11S,13R,16S)-2,11,13,16-tetraacetyloxy-5,5,9-trimethyl-14-methylidene-15-oxo-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
|---|---|
| PubChem CID | 95242394 |
| Molecular Formula | C30H40O11 |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | [(1R,2R,4R,8R,9R,10R,11S,13R,16S)-2,11,13,16-tetraacetyloxy-5,5,9-trimethyl-14-methylidene-15-oxo-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
| SMILES | C=C1C(=O)[C@@]23[C@H]([C@@H](OC(C)=O)C[C@]1(OC(C)=O)[C@H]2OC(C)=O)[C@@]1(C)[C@H](C[C@H]3OC(C)=O)C(C)(C)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H40O11/c1-14-25(36)30-23(39-17(4)33)12-21-27(7,8)11-10-22(38-16(3)32)28(21,9)24(30)20(37-15(2)31)13-29(14,41-19(6)35)26(30)40-18(5)34/h20-24,26H,1,10-13H2,2-9H3/t20-,21+,22+,23+,24+,26+,28-,29+,30+/m0/s1 |
| InChIKey | YOYFIXDRWBRSOW-ZQBJOWDYSA-N |
| XLogP | 3.01 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|