C24H34O8 — CID 146028214
[(4R,8R,9R,13R)-11-acetyloxy-2,13,16-trihydroxy-5,5,9-trimethyl-14-methylidene-15-oxo-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate (PubChem CID 146028214) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is [(4R,8R,9R,13R)-11-acetyloxy-2,13,16-trihydroxy-5,5,9-trimethyl-14-methylidene-15-oxo-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate.
| Compound Name | [(4R,8R,9R,13R)-11-acetyloxy-2,13,16-trihydroxy-5,5,9-trimethyl-14-methylidene-15-oxo-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
|---|---|
| PubChem CID | 146028214 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [(4R,8R,9R,13R)-11-acetyloxy-2,13,16-trihydroxy-5,5,9-trimethyl-14-methylidene-15-oxo-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
| SMILES | C=C1C(=O)C23C(O)C[C@@H]4C(C)(C)CC[C@@H](OC(C)=O)[C@@]4(C)C2C(OC(C)=O)C[C@]1(O)C3O |
| InChI | InChI=1S/C24H34O8/c1-11-19(28)24-16(27)9-15-21(4,5)8-7-17(32-13(3)26)22(15,6)18(24)14(31-12(2)25)10-23(11,30)20(24)29/h14-18,20,27,29-30H,1,7-10H2,2-6H3/t14?,15-,16?,17-,18?,20?,22+,23-,24?/m1/s1 |
| InChIKey | OGCASFWCVLELAH-JYVMFCERSA-N |
| XLogP | 1.29 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|