C10H14O — CID 95858532
(1R,5R,6R)-tricyclo[4.2.2.01,5]decan-8-one (PubChem CID 95858532) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (1R,5R,6R)-tricyclo[4.2.2.01,5]decan-8-one.
| Compound Name | (1R,5R,6R)-tricyclo[4.2.2.01,5]decan-8-one |
|---|---|
| PubChem CID | 95858532 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (1R,5R,6R)-tricyclo[4.2.2.01,5]decan-8-one |
| SMILES | O=C1C[C@H]2CC[C@@]13CCC[C@H]23 |
| InChI | InChI=1S/C10H14O/c11-9-6-7-3-5-10(9)4-1-2-8(7)10/h7-8H,1-6H2/t7-,8-,10-/m1/s1 |
| InChIKey | ZYUNDPQOGAZCBE-NQMVMOMDSA-N |
| XLogP | 2.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |