C12H18O2 — CID 101488524
(1S,5R,6S,8R)-5-hydroxytricyclo[6.2.2.01,6]dodecan-10-one (PubChem CID 101488524) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (1S,5R,6S,8R)-5-hydroxytricyclo[6.2.2.01,6]dodecan-10-one.
| Compound Name | (1S,5R,6S,8R)-5-hydroxytricyclo[6.2.2.01,6]dodecan-10-one |
|---|---|
| PubChem CID | 101488524 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (1S,5R,6S,8R)-5-hydroxytricyclo[6.2.2.01,6]dodecan-10-one |
| SMILES | O=C1C[C@@H]2CC[C@]13CCC[C@@H](O)[C@H]3C2 |
| InChI | InChI=1S/C12H18O2/c13-10-2-1-4-12-5-3-8(6-9(10)12)7-11(12)14/h8-10,13H,1-7H2/t8-,9-,10-,12+/m1/s1 |
| InChIKey | DWNQSTXWYJDQLW-BFLSOPEQSA-N |
| XLogP | 1.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |