C12H20O — CID 22212489
(3R,4aS,8aR)-3,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one (PubChem CID 22212489) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (3R,4aS,8aR)-3,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one.
| Compound Name | (3R,4aS,8aR)-3,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one |
|---|---|
| PubChem CID | 22212489 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (3R,4aS,8aR)-3,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one |
| SMILES | C[C@H]1CC(=O)[C@]2(C)CCCC[C@H]2C1 |
| InChI | InChI=1S/C12H20O/c1-9-7-10-5-3-4-6-12(10,2)11(13)8-9/h9-10H,3-8H2,1-2H3/t9-,10+,12-/m1/s1 |
| InChIKey | LARGNBGMOKQPKC-JFGNBEQYSA-N |
| XLogP | 3.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |