C9H15NO2 — CID 131027015
(4aS,9aS)-4,4a,5,6,7,8,9,9a-octahydro-3H-cyclohepta[e][1,3]oxazin-2-one (PubChem CID 131027015) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (4aS,9aS)-4,4a,5,6,7,8,9,9a-octahydro-3H-cyclohepta[e][1,3]oxazin-2-one.
| Compound Name | (4aS,9aS)-4,4a,5,6,7,8,9,9a-octahydro-3H-cyclohepta[e][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 131027015 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (4aS,9aS)-4,4a,5,6,7,8,9,9a-octahydro-3H-cyclohepta[e][1,3]oxazin-2-one |
| SMILES | O=C1NC[C@@H]2CCCCC[C@@H]2O1 |
| InChI | InChI=1S/C9H15NO2/c11-9-10-6-7-4-2-1-3-5-8(7)12-9/h7-8H,1-6H2,(H,10,11)/t7-,8-/m0/s1 |
| InChIKey | QOEJBZKMQMDEDZ-YUMQZZPRSA-N |
| XLogP | 1.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |