C8H13NO4S — CID 117158781
5-(1,1-dioxothian-2-yl)-1,3-oxazolidin-2-one (PubChem CID 117158781) has the molecular formula C8H13NO4S and a molecular weight of 219.26 g/mol. Its IUPAC name is 5-(1,1-dioxothian-2-yl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(1,1-dioxothian-2-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 117158781 |
| Molecular Formula | C8H13NO4S |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 5-(1,1-dioxothian-2-yl)-1,3-oxazolidin-2-one |
| SMILES | O=C1NCC(C2CCCCS2(=O)=O)O1 |
| InChI | InChI=1S/C8H13NO4S/c10-8-9-5-6(13-8)7-3-1-2-4-14(7,11)12/h6-7H,1-5H2,(H,9,10) |
| InChIKey | KFLDRTAYSNKNCZ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |