C9H17NO2S — CID 173061390
2-cyclopentyl-1,4-thiazinane 1,1-dioxide (PubChem CID 173061390) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is 2-cyclopentyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 2-cyclopentyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 173061390 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | 2-cyclopentyl-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCNCC1C1CCCC1 |
| InChI | InChI=1S/C9H17NO2S/c11-13(12)6-5-10-7-9(13)8-3-1-2-4-8/h8-10H,1-7H2 |
| InChIKey | IVVZRSWDWPCZQK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |