C7H13NO2S — CID 124680559
(2R)-2-cyclopropyl-1,4-thiazinane 1,1-dioxide (PubChem CID 124680559) has the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. Its IUPAC name is (2R)-2-cyclopropyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | (2R)-2-cyclopropyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 124680559 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | (2R)-2-cyclopropyl-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCNC[C@H]1C1CC1 |
| InChI | InChI=1S/C7H13NO2S/c9-11(10)4-3-8-5-7(11)6-1-2-6/h6-8H,1-5H2/t7-/m0/s1 |
| InChIKey | MVUMOXFMZAEWRC-ZETCQYMHSA-N |
| XLogP | -0.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |