C10H13ClINO2S — CID 66654177
2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride (PubChem CID 66654177) has the molecular formula C10H13ClINO2S and a molecular weight of 373.64 g/mol. Its IUPAC name is 2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride.
| Compound Name | 2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride |
|---|---|
| PubChem CID | 66654177 |
| Molecular Formula | C10H13ClINO2S |
| Molecular Weight | 373.64 g/mol |
| Exact Mass | 372.94 |
| IUPAC Name | 2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride |
| SMILES | Cl.O=S1(=O)CCNCC1c1ccc(I)cc1 |
| InChI | InChI=1S/C10H12INO2S.ClH/c11-9-3-1-8(2-4-9)10-7-12-5-6-15(10,13)14;/h1-4,10,12H,5-7H2;1H |
| InChIKey | IPQNMFSKBHDAHB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.64 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|