About 2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride
2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride (PubChem CID 66654177) has the molecular formula C10H13ClINO2S
and a molecular weight of 373.64 g/mol. Its IUPAC name is 2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride.
Molecular Properties
| Compound Name | 2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride |
| PubChem CID | 66654177 |
| Molecular Formula | C10H13ClINO2S |
| Molecular Weight | 373.64 g/mol |
| Exact Mass | 372.94 |
| IUPAC Name | 2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride |
| SMILES | Cl.O=S1(=O)CCNCC1c1ccc(I)cc1 |
| InChI | InChI=1S/C10H12INO2S.ClH/c11-9-3-1-8(2-4-9)10-7-12-5-6-15(10,13)14;/h1-4,10,12H,5-7H2;1H |
| InChIKey | IPQNMFSKBHDAHB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.64 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride?
The IUPAC name of 2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride (CID 66654177) is 2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride.
What is the SMILES notation for 2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride?
The canonical SMILES for 2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride is Cl.O=S1(=O)CCNCC1c1ccc(I)cc1.
What is the InChIKey of 2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride?
The InChIKey is IPQNMFSKBHDAHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12INO2S.ClH/c11-9-3-1-8(2-4-9)10-7-12-5-6-15(10,13)14;/h1-4,10,12H,5-7H2;1H.
What are the key properties of 2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride?
2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride has a molecular weight of 373.64 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-iodophenyl)-1,4-thiazinane 1,1-dioxide;hydrochloride is sourced from PubChem (CID 66654177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).