C13H23NO2S — CID 112570757
6-cyclopentyl-2λ6-thia-8-azaspiro[4.5]decane 2,2-dioxide (PubChem CID 112570757) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is 6-cyclopentyl-2λ6-thia-8-azaspiro[4.5]decane 2,2-dioxide.
| Compound Name | 6-cyclopentyl-2λ6-thia-8-azaspiro[4.5]decane 2,2-dioxide |
|---|---|
| PubChem CID | 112570757 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 6-cyclopentyl-2λ6-thia-8-azaspiro[4.5]decane 2,2-dioxide |
| SMILES | O=S1(=O)CCC2(CCNCC2C2CCCC2)C1 |
| InChI | InChI=1S/C13H23NO2S/c15-17(16)8-6-13(10-17)5-7-14-9-12(13)11-3-1-2-4-11/h11-12,14H,1-10H2 |
| InChIKey | XEWXRKNZJZHBJQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |