C19H31N — CID 115927123
3'-cyclopentylspiro[adamantane-2,4'-piperidine] (PubChem CID 115927123) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 3'-cyclopentylspiro[adamantane-2,4'-piperidine].
| Compound Name | 3'-cyclopentylspiro[adamantane-2,4'-piperidine] |
|---|---|
| PubChem CID | 115927123 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 3'-cyclopentylspiro[adamantane-2,4'-piperidine] |
| SMILES | C1CCC(C2CNCCC23C2CC4CC(C2)CC3C4)C1 |
| InChI | InChI=1S/C19H31N/c1-2-4-15(3-1)18-12-20-6-5-19(18)16-8-13-7-14(10-16)11-17(19)9-13/h13-18,20H,1-12H2 |
| InChIKey | SUIJYLMWVVVNEV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |