C12H23NO2S — CID 79320236
11-propyl-2λ6-thia-9-azaspiro[5.5]undecane 2,2-dioxide (PubChem CID 79320236) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is 11-propyl-2λ6-thia-9-azaspiro[5.5]undecane 2,2-dioxide.
| Compound Name | 11-propyl-2λ6-thia-9-azaspiro[5.5]undecane 2,2-dioxide |
|---|---|
| PubChem CID | 79320236 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 11-propyl-2λ6-thia-9-azaspiro[5.5]undecane 2,2-dioxide |
| SMILES | CCCC1CNCCC12CCCS(=O)(=O)C2 |
| InChI | InChI=1S/C12H23NO2S/c1-2-4-11-9-13-7-6-12(11)5-3-8-16(14,15)10-12/h11,13H,2-10H2,1H3 |
| InChIKey | YWWIPGOQGYOASW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |