About 11-ethyl-2,2-dioxo-2λ6-thia-9-azaspiro[5.5]undecane-8,10-dione
11-ethyl-2,2-dioxo-2λ6-thia-9-azaspiro[5.5]undecane-8,10-dione (PubChem CID 79320480) has the molecular formula C11H17NO4S
and a molecular weight of 259.33 g/mol. Its IUPAC name is 11-ethyl-2,2-dioxo-2λ6-thia-9-azaspiro[5.5]undecane-8,10-dione.
Molecular Properties
| Compound Name | 11-ethyl-2,2-dioxo-2λ6-thia-9-azaspiro[5.5]undecane-8,10-dione |
| PubChem CID | 79320480 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 11-ethyl-2,2-dioxo-2λ6-thia-9-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CCC1C(=O)NC(=O)CC12CCCS(=O)(=O)C2 |
| InChI | InChI=1S/C11H17NO4S/c1-2-8-10(14)12-9(13)6-11(8)4-3-5-17(15,16)7-11/h8H,2-7H2,1H3,(H,12,13,14) |
| InChIKey | FTCZVWSMLOPENK-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 11-ethyl-2,2-dioxo-2λ6-thia-9-azaspiro[5.5]undecane-8,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-ethyl-2,2-dioxo-2λ6-thia-9-azaspiro[5.5]undecane-8,10-dione?
The IUPAC name of 11-ethyl-2,2-dioxo-2λ6-thia-9-azaspiro[5.5]undecane-8,10-dione (CID 79320480) is 11-ethyl-2,2-dioxo-2λ6-thia-9-azaspiro[5.5]undecane-8,10-dione.
What is the SMILES notation for 11-ethyl-2,2-dioxo-2λ6-thia-9-azaspiro[5.5]undecane-8,10-dione?
The canonical SMILES for 11-ethyl-2,2-dioxo-2λ6-thia-9-azaspiro[5.5]undecane-8,10-dione is CCC1C(=O)NC(=O)CC12CCCS(=O)(=O)C2.
What is the InChIKey of 11-ethyl-2,2-dioxo-2λ6-thia-9-azaspiro[5.5]undecane-8,10-dione?
The InChIKey is FTCZVWSMLOPENK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO4S/c1-2-8-10(14)12-9(13)6-11(8)4-3-5-17(15,16)7-11/h8H,2-7H2,1H3,(H,12,13,14).
What are the key properties of 11-ethyl-2,2-dioxo-2λ6-thia-9-azaspiro[5.5]undecane-8,10-dione?
11-ethyl-2,2-dioxo-2λ6-thia-9-azaspiro[5.5]undecane-8,10-dione has a molecular weight of 259.33 g/mol, XLogP of 0.25, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 11-ethyl-2,2-dioxo-2λ6-thia-9-azaspiro[5.5]undecane-8,10-dione is sourced from PubChem (CID 79320480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).