C16H27NO2 — CID 79321065
9-tert-butyl-5-ethyl-3-azaspiro[5.5]undecane-2,4-dione (PubChem CID 79321065) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 9-tert-butyl-5-ethyl-3-azaspiro[5.5]undecane-2,4-dione.
| Compound Name | 9-tert-butyl-5-ethyl-3-azaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 79321065 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 9-tert-butyl-5-ethyl-3-azaspiro[5.5]undecane-2,4-dione |
| SMILES | CCC1C(=O)NC(=O)CC12CCC(C(C)(C)C)CC2 |
| InChI | InChI=1S/C16H27NO2/c1-5-12-14(19)17-13(18)10-16(12)8-6-11(7-9-16)15(2,3)4/h11-12H,5-10H2,1-4H3,(H,17,18,19) |
| InChIKey | YCXZUBDZEHTRHF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|