About 2-methyl-6-propyl-2,8-diazaspiro[4.5]decane-7,9-dione
2-methyl-6-propyl-2,8-diazaspiro[4.5]decane-7,9-dione (PubChem CID 79318050) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-methyl-6-propyl-2,8-diazaspiro[4.5]decane-7,9-dione.
Molecular Properties
| Compound Name | 2-methyl-6-propyl-2,8-diazaspiro[4.5]decane-7,9-dione |
| PubChem CID | 79318050 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-methyl-6-propyl-2,8-diazaspiro[4.5]decane-7,9-dione |
| SMILES | CCCC1C(=O)NC(=O)CC12CCN(C)C2 |
| InChI | InChI=1S/C12H20N2O2/c1-3-4-9-11(16)13-10(15)7-12(9)5-6-14(2)8-12/h9H,3-8H2,1-2H3,(H,13,15,16) |
| InChIKey | FSZRNNGYJXTLEH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-propyl-2,8-diazaspiro[4.5]decane-7,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-propyl-2,8-diazaspiro[4.5]decane-7,9-dione?
The IUPAC name of 2-methyl-6-propyl-2,8-diazaspiro[4.5]decane-7,9-dione (CID 79318050) is 2-methyl-6-propyl-2,8-diazaspiro[4.5]decane-7,9-dione.
What is the SMILES notation for 2-methyl-6-propyl-2,8-diazaspiro[4.5]decane-7,9-dione?
The canonical SMILES for 2-methyl-6-propyl-2,8-diazaspiro[4.5]decane-7,9-dione is CCCC1C(=O)NC(=O)CC12CCN(C)C2.
What is the InChIKey of 2-methyl-6-propyl-2,8-diazaspiro[4.5]decane-7,9-dione?
The InChIKey is FSZRNNGYJXTLEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2/c1-3-4-9-11(16)13-10(15)7-12(9)5-6-14(2)8-12/h9H,3-8H2,1-2H3,(H,13,15,16).
What are the key properties of 2-methyl-6-propyl-2,8-diazaspiro[4.5]decane-7,9-dione?
2-methyl-6-propyl-2,8-diazaspiro[4.5]decane-7,9-dione has a molecular weight of 224.30 g/mol, XLogP of 0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-propyl-2,8-diazaspiro[4.5]decane-7,9-dione is sourced from PubChem (CID 79318050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).