C13H23NO2 — CID 79321261
3-ethyl-4,4-dipropylpiperidine-2,6-dione (PubChem CID 79321261) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 3-ethyl-4,4-dipropylpiperidine-2,6-dione.
| Compound Name | 3-ethyl-4,4-dipropylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 79321261 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 3-ethyl-4,4-dipropylpiperidine-2,6-dione |
| SMILES | CCCC1(CCC)CC(=O)NC(=O)C1CC |
| InChI | InChI=1S/C13H23NO2/c1-4-7-13(8-5-2)9-11(15)14-12(16)10(13)6-3/h10H,4-9H2,1-3H3,(H,14,15,16) |
| InChIKey | TYJVDDLOLPHHRZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|