About 1-(2-methylpropyl)-9,9-dioxo-9λ6-thia-2-azaspiro[4.5]decan-3-one
1-(2-methylpropyl)-9,9-dioxo-9λ6-thia-2-azaspiro[4.5]decan-3-one (PubChem CID 66108308) has the molecular formula C12H21NO3S
and a molecular weight of 259.37 g/mol. Its IUPAC name is 1-(2-methylpropyl)-9,9-dioxo-9λ6-thia-2-azaspiro[4.5]decan-3-one.
Molecular Properties
| Compound Name | 1-(2-methylpropyl)-9,9-dioxo-9λ6-thia-2-azaspiro[4.5]decan-3-one |
| PubChem CID | 66108308 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-(2-methylpropyl)-9,9-dioxo-9λ6-thia-2-azaspiro[4.5]decan-3-one |
| SMILES | CC(C)CC1NC(=O)CC12CCCS(=O)(=O)C2 |
| InChI | InChI=1S/C12H21NO3S/c1-9(2)6-10-12(7-11(14)13-10)4-3-5-17(15,16)8-12/h9-10H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | LKIISICXQYMOGN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-methylpropyl)-9,9-dioxo-9λ6-thia-2-azaspiro[4.5]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylpropyl)-9,9-dioxo-9λ6-thia-2-azaspiro[4.5]decan-3-one?
The IUPAC name of 1-(2-methylpropyl)-9,9-dioxo-9λ6-thia-2-azaspiro[4.5]decan-3-one (CID 66108308) is 1-(2-methylpropyl)-9,9-dioxo-9λ6-thia-2-azaspiro[4.5]decan-3-one.
What is the SMILES notation for 1-(2-methylpropyl)-9,9-dioxo-9λ6-thia-2-azaspiro[4.5]decan-3-one?
The canonical SMILES for 1-(2-methylpropyl)-9,9-dioxo-9λ6-thia-2-azaspiro[4.5]decan-3-one is CC(C)CC1NC(=O)CC12CCCS(=O)(=O)C2.
What is the InChIKey of 1-(2-methylpropyl)-9,9-dioxo-9λ6-thia-2-azaspiro[4.5]decan-3-one?
The InChIKey is LKIISICXQYMOGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3S/c1-9(2)6-10-12(7-11(14)13-10)4-3-5-17(15,16)8-12/h9-10H,3-8H2,1-2H3,(H,13,14).
What are the key properties of 1-(2-methylpropyl)-9,9-dioxo-9λ6-thia-2-azaspiro[4.5]decan-3-one?
1-(2-methylpropyl)-9,9-dioxo-9λ6-thia-2-azaspiro[4.5]decan-3-one has a molecular weight of 259.37 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylpropyl)-9,9-dioxo-9λ6-thia-2-azaspiro[4.5]decan-3-one is sourced from PubChem (CID 66108308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).