C12H23NO — CID 66108525
4,4-diethyl-5-(2-methylpropyl)pyrrolidin-2-one (PubChem CID 66108525) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 4,4-diethyl-5-(2-methylpropyl)pyrrolidin-2-one.
| Compound Name | 4,4-diethyl-5-(2-methylpropyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 66108525 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 4,4-diethyl-5-(2-methylpropyl)pyrrolidin-2-one |
| SMILES | CCC1(CC)CC(=O)NC1CC(C)C |
| InChI | InChI=1S/C12H23NO/c1-5-12(6-2)8-11(14)13-10(12)7-9(3)4/h9-10H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | NGLBSJBRNBZVNV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |