C18H28N2 — CID 79321591
2-benzyl-6-propyl-2,8-diazaspiro[4.5]decane (PubChem CID 79321591) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 2-benzyl-6-propyl-2,8-diazaspiro[4.5]decane.
| Compound Name | 2-benzyl-6-propyl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 79321591 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 2-benzyl-6-propyl-2,8-diazaspiro[4.5]decane |
| SMILES | CCCC1CNCCC12CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C18H28N2/c1-2-6-17-13-19-11-9-18(17)10-12-20(15-18)14-16-7-4-3-5-8-16/h3-5,7-8,17,19H,2,6,9-15H2,1H3 |
| InChIKey | QQHJHHDJOTVANH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |