C17H26N2 — CID 83851488
2-benzyl-1-ethyl-2,8-diazaspiro[4.5]decane (PubChem CID 83851488) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-benzyl-1-ethyl-2,8-diazaspiro[4.5]decane.
| Compound Name | 2-benzyl-1-ethyl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 83851488 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2-benzyl-1-ethyl-2,8-diazaspiro[4.5]decane |
| SMILES | CCC1N(Cc2ccccc2)CCC12CCNCC2 |
| InChI | InChI=1S/C17H26N2/c1-2-16-17(8-11-18-12-9-17)10-13-19(16)14-15-6-4-3-5-7-15/h3-7,16,18H,2,8-14H2,1H3 |
| InChIKey | BCFUIHYOCDWJHU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |