C17H26N2 — CID 83488647
1-benzyl-4,4-dimethyl-2,3,4a,5,6,7,8,8a-octahydro-1,6-naphthyridine (PubChem CID 83488647) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-benzyl-4,4-dimethyl-2,3,4a,5,6,7,8,8a-octahydro-1,6-naphthyridine.
| Compound Name | 1-benzyl-4,4-dimethyl-2,3,4a,5,6,7,8,8a-octahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 83488647 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1-benzyl-4,4-dimethyl-2,3,4a,5,6,7,8,8a-octahydro-1,6-naphthyridine |
| SMILES | CC1(C)CCN(Cc2ccccc2)C2CCNCC21 |
| InChI | InChI=1S/C17H26N2/c1-17(2)9-11-19(13-14-6-4-3-5-7-14)16-8-10-18-12-15(16)17/h3-7,15-16,18H,8-13H2,1-2H3 |
| InChIKey | WEOUOCZEZPJAKT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |