C15H22N2 — CID 83850406
2-benzyl-1-methyl-2,7-diazaspiro[4.4]nonane (PubChem CID 83850406) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 2-benzyl-1-methyl-2,7-diazaspiro[4.4]nonane.
| Compound Name | 2-benzyl-1-methyl-2,7-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 83850406 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-benzyl-1-methyl-2,7-diazaspiro[4.4]nonane |
| SMILES | CC1N(Cc2ccccc2)CCC12CCNC2 |
| InChI | InChI=1S/C15H22N2/c1-13-15(7-9-16-12-15)8-10-17(13)11-14-5-3-2-4-6-14/h2-6,13,16H,7-12H2,1H3 |
| InChIKey | MBOUWASPYMYHHZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |