C17H30N2 — CID 178143543
(3aR,8aR)-4-benzyl-2,3,3a,5,6,7,8,8a-octahydro-1H-pyrrolo[3,2-b]azepine;ethane;molecular hydrogen (PubChem CID 178143543) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is (3aR,8aR)-4-benzyl-2,3,3a,5,6,7,8,8a-octahydro-1H-pyrrolo[3,2-b]azepine;ethane;molecular hydrogen.
| Compound Name | (3aR,8aR)-4-benzyl-2,3,3a,5,6,7,8,8a-octahydro-1H-pyrrolo[3,2-b]azepine;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 178143543 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | (3aR,8aR)-4-benzyl-2,3,3a,5,6,7,8,8a-octahydro-1H-pyrrolo[3,2-b]azepine;ethane;molecular hydrogen |
| SMILES | CC.[H][H].c1ccc(CN2CCCC[C@H]3NCC[C@H]32)cc1 |
| InChI | InChI=1S/C15H22N2.C2H6.H2/c1-2-6-13(7-3-1)12-17-11-5-4-8-14-15(17)9-10-16-14;1-2;/h1-3,6-7,14-16H,4-5,8-12H2;1-2H3;1H/t14-,15-;;/m1../s1 |
| InChIKey | UGQQNQLFOQFBIY-FXUMYAARSA-N |
| XLogP | 3.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |