C19H28N2 — CID 79972574
1-[(3-cyclopropylphenyl)methyl]-2-pyrrolidin-2-ylpiperidine (PubChem CID 79972574) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 1-[(3-cyclopropylphenyl)methyl]-2-pyrrolidin-2-ylpiperidine.
| Compound Name | 1-[(3-cyclopropylphenyl)methyl]-2-pyrrolidin-2-ylpiperidine |
|---|---|
| PubChem CID | 79972574 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 1-[(3-cyclopropylphenyl)methyl]-2-pyrrolidin-2-ylpiperidine |
| SMILES | c1cc(CN2CCCCC2C2CCCN2)cc(C2CC2)c1 |
| InChI | InChI=1S/C19H28N2/c1-2-12-21(19(8-1)18-7-4-11-20-18)14-15-5-3-6-17(13-15)16-9-10-16/h3,5-6,13,16,18-20H,1-2,4,7-12,14H2 |
| InChIKey | AOYJFVVFFWCSKP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |