C15H21ClN2 — CID 178143434
(3aR,8aR)-4-[(3-chlorophenyl)methyl]-2,3,3a,5,6,7,8,8a-octahydro-1H-pyrrolo[3,2-b]azepine (PubChem CID 178143434) has the molecular formula C15H21ClN2 and a molecular weight of 264.80 g/mol. Its IUPAC name is (3aR,8aR)-4-[(3-chlorophenyl)methyl]-2,3,3a,5,6,7,8,8a-octahydro-1H-pyrrolo[3,2-b]azepine.
| Compound Name | (3aR,8aR)-4-[(3-chlorophenyl)methyl]-2,3,3a,5,6,7,8,8a-octahydro-1H-pyrrolo[3,2-b]azepine |
|---|---|
| PubChem CID | 178143434 |
| Molecular Formula | C15H21ClN2 |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (3aR,8aR)-4-[(3-chlorophenyl)methyl]-2,3,3a,5,6,7,8,8a-octahydro-1H-pyrrolo[3,2-b]azepine |
| SMILES | Clc1cccc(CN2CCCC[C@H]3NCC[C@H]32)c1 |
| InChI | InChI=1S/C15H21ClN2/c16-13-5-3-4-12(10-13)11-18-9-2-1-6-14-15(18)7-8-17-14/h3-5,10,14-15,17H,1-2,6-9,11H2/t14-,15-/m1/s1 |
| InChIKey | YDBOACMKKWCSMC-HUUCEWRRSA-N |
| XLogP | 3.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |