C15H20N2O — CID 124575094
(4aS,8aS)-4-benzyl-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one (PubChem CID 124575094) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (4aS,8aS)-4-benzyl-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one.
| Compound Name | (4aS,8aS)-4-benzyl-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
|---|---|
| PubChem CID | 124575094 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (4aS,8aS)-4-benzyl-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
| SMILES | O=C1CN(Cc2ccccc2)[C@H]2CCCC[C@@H]2N1 |
| InChI | InChI=1S/C15H20N2O/c18-15-11-17(10-12-6-2-1-3-7-12)14-9-5-4-8-13(14)16-15/h1-3,6-7,13-14H,4-5,8-11H2,(H,16,18)/t13-,14-/m0/s1 |
| InChIKey | JSFYAZUQEZPWOZ-KBPBESRZSA-N |
| XLogP | 1.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |