C16H22N2O — CID 178143548
(4aS,9aR)-1-benzyl-3,4,4a,5,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-6-one (PubChem CID 178143548) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is (4aS,9aR)-1-benzyl-3,4,4a,5,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-6-one.
| Compound Name | (4aS,9aR)-1-benzyl-3,4,4a,5,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-6-one |
|---|---|
| PubChem CID | 178143548 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (4aS,9aR)-1-benzyl-3,4,4a,5,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-6-one |
| SMILES | O=C1CCC[C@@H]2[C@H](CCCN2Cc2ccccc2)N1 |
| InChI | InChI=1S/C16H22N2O/c19-16-10-4-9-15-14(17-16)8-5-11-18(15)12-13-6-2-1-3-7-13/h1-3,6-7,14-15H,4-5,8-12H2,(H,17,19)/t14-,15+/m0/s1 |
| InChIKey | SVKVNJYYNNDBQP-LSDHHAIUSA-N |
| XLogP | 2.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |