C14H19N3O — CID 97084995
(4aS,8aR)-4-(pyridin-4-ylmethyl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one (PubChem CID 97084995) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is (4aS,8aR)-4-(pyridin-4-ylmethyl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one.
| Compound Name | (4aS,8aR)-4-(pyridin-4-ylmethyl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
|---|---|
| PubChem CID | 97084995 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | (4aS,8aR)-4-(pyridin-4-ylmethyl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
| SMILES | O=C1CN(Cc2ccncc2)[C@H]2CCCC[C@H]2N1 |
| InChI | InChI=1S/C14H19N3O/c18-14-10-17(9-11-5-7-15-8-6-11)13-4-2-1-3-12(13)16-14/h5-8,12-13H,1-4,9-10H2,(H,16,18)/t12-,13+/m1/s1 |
| InChIKey | MJMSICILYIQAGZ-OLZOCXBDSA-N |
| XLogP | 1.32 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |