C16H24N2O — CID 99728174
[(4S)-2-benzyl-2,8-diazaspiro[4.5]decan-4-yl]methanol (PubChem CID 99728174) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is [(4S)-2-benzyl-2,8-diazaspiro[4.5]decan-4-yl]methanol.
| Compound Name | [(4S)-2-benzyl-2,8-diazaspiro[4.5]decan-4-yl]methanol |
|---|---|
| PubChem CID | 99728174 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | [(4S)-2-benzyl-2,8-diazaspiro[4.5]decan-4-yl]methanol |
| SMILES | OC[C@@H]1CN(Cc2ccccc2)CC12CCNCC2 |
| InChI | InChI=1S/C16H24N2O/c19-12-15-11-18(10-14-4-2-1-3-5-14)13-16(15)6-8-17-9-7-16/h1-5,15,17,19H,6-13H2/t15-/m0/s1 |
| InChIKey | UMYNZFZEJVNNGG-HNNXBMFYSA-N |
| XLogP | 1.48 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |