C18H28N2O2 — CID 91921720
[2-[(3-ethoxyphenyl)methyl]-2,8-diazaspiro[4.5]decan-4-yl]methanol (PubChem CID 91921720) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is [2-[(3-ethoxyphenyl)methyl]-2,8-diazaspiro[4.5]decan-4-yl]methanol.
| Compound Name | [2-[(3-ethoxyphenyl)methyl]-2,8-diazaspiro[4.5]decan-4-yl]methanol |
|---|---|
| PubChem CID | 91921720 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | [2-[(3-ethoxyphenyl)methyl]-2,8-diazaspiro[4.5]decan-4-yl]methanol |
| SMILES | CCOc1cccc(CN2CC(CO)C3(CCNCC3)C2)c1 |
| InChI | InChI=1S/C18H28N2O2/c1-2-22-17-5-3-4-15(10-17)11-20-12-16(13-21)18(14-20)6-8-19-9-7-18/h3-5,10,16,19,21H,2,6-9,11-14H2,1H3 |
| InChIKey | HFXWYACXSIONKT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |