C19H21NO3S — CID 90766564
[3-[(3-ethoxyphenyl)methyl]-3-azabicyclo[3.1.0]hexan-1-yl] thiophene-2-carboxylate (PubChem CID 90766564) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is [3-[(3-ethoxyphenyl)methyl]-3-azabicyclo[3.1.0]hexan-1-yl] thiophene-2-carboxylate.
| Compound Name | [3-[(3-ethoxyphenyl)methyl]-3-azabicyclo[3.1.0]hexan-1-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 90766564 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | [3-[(3-ethoxyphenyl)methyl]-3-azabicyclo[3.1.0]hexan-1-yl] thiophene-2-carboxylate |
| SMILES | CCOc1cccc(CN2CC3CC3(OC(=O)c3cccs3)C2)c1 |
| InChI | InChI=1S/C19H21NO3S/c1-2-22-16-6-3-5-14(9-16)11-20-12-15-10-19(15,13-20)23-18(21)17-7-4-8-24-17/h3-9,15H,2,10-13H2,1H3 |
| InChIKey | ZPUINCOGRFDYAT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |