About 3'-propylspiro[1,3-dihydroindene-2,4'-piperidine]
3'-propylspiro[1,3-dihydroindene-2,4'-piperidine] (PubChem CID 79320324) has the molecular formula C16H23N
and a molecular weight of 229.37 g/mol. Its IUPAC name is 3'-propylspiro[1,3-dihydroindene-2,4'-piperidine].
Molecular Properties
| Compound Name | 3'-propylspiro[1,3-dihydroindene-2,4'-piperidine] |
| PubChem CID | 79320324 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 3'-propylspiro[1,3-dihydroindene-2,4'-piperidine] |
| SMILES | CCCC1CNCCC12Cc1ccccc1C2 |
| InChI | InChI=1S/C16H23N/c1-2-5-15-12-17-9-8-16(15)10-13-6-3-4-7-14(13)11-16/h3-4,6-7,15,17H,2,5,8-12H2,1H3 |
| InChIKey | MDEBKIOQTKUEOA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3'-propylspiro[1,3-dihydroindene-2,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-propylspiro[1,3-dihydroindene-2,4'-piperidine]?
The IUPAC name of 3'-propylspiro[1,3-dihydroindene-2,4'-piperidine] (CID 79320324) is 3'-propylspiro[1,3-dihydroindene-2,4'-piperidine].
What is the SMILES notation for 3'-propylspiro[1,3-dihydroindene-2,4'-piperidine]?
The canonical SMILES for 3'-propylspiro[1,3-dihydroindene-2,4'-piperidine] is CCCC1CNCCC12Cc1ccccc1C2.
What is the InChIKey of 3'-propylspiro[1,3-dihydroindene-2,4'-piperidine]?
The InChIKey is MDEBKIOQTKUEOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N/c1-2-5-15-12-17-9-8-16(15)10-13-6-3-4-7-14(13)11-16/h3-4,6-7,15,17H,2,5,8-12H2,1H3.
What are the key properties of 3'-propylspiro[1,3-dihydroindene-2,4'-piperidine]?
3'-propylspiro[1,3-dihydroindene-2,4'-piperidine] has a molecular weight of 229.37 g/mol, XLogP of 3.18, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-propylspiro[1,3-dihydroindene-2,4'-piperidine] is sourced from PubChem (CID 79320324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).