About [2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-pyran-4-yl] 2-ethylbutanoate
[2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-pyran-4-yl] 2-ethylbutanoate (PubChem CID 121445159) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is [2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-pyran-4-yl] 2-ethylbutanoate.
Molecular Properties
| Compound Name | [2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-pyran-4-yl] 2-ethylbutanoate |
| PubChem CID | 121445159 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | [2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-pyran-4-yl] 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)OC1C=COC(CO)C1C |
| InChI | InChI=1S/C13H22O4/c1-4-10(5-2)13(15)17-11-6-7-16-12(8-14)9(11)3/h6-7,9-12,14H,4-5,8H2,1-3H3 |
| InChIKey | YKSLMORHPGDUSQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-pyran-4-yl] 2-ethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-pyran-4-yl] 2-ethylbutanoate?
The IUPAC name of [2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-pyran-4-yl] 2-ethylbutanoate (CID 121445159) is [2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-pyran-4-yl] 2-ethylbutanoate.
What is the SMILES notation for [2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-pyran-4-yl] 2-ethylbutanoate?
The canonical SMILES for [2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-pyran-4-yl] 2-ethylbutanoate is CCC(CC)C(=O)OC1C=COC(CO)C1C.
What is the InChIKey of [2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-pyran-4-yl] 2-ethylbutanoate?
The InChIKey is YKSLMORHPGDUSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4/c1-4-10(5-2)13(15)17-11-6-7-16-12(8-14)9(11)3/h6-7,9-12,14H,4-5,8H2,1-3H3.
What are the key properties of [2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-pyran-4-yl] 2-ethylbutanoate?
[2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-pyran-4-yl] 2-ethylbutanoate has a molecular weight of 242.31 g/mol, XLogP of 1.88, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(hydroxymethyl)-3-methyl-3,4-dihydro-2H-pyran-4-yl] 2-ethylbutanoate is sourced from PubChem (CID 121445159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).