C6H10O4 — CID 141230535
2,4-dimethoxy-4H-1,3-dioxine (PubChem CID 141230535) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is 2,4-dimethoxy-4H-1,3-dioxine.
| Compound Name | 2,4-dimethoxy-4H-1,3-dioxine |
|---|---|
| PubChem CID | 141230535 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 2,4-dimethoxy-4H-1,3-dioxine |
| SMILES | COC1C=COC(OC)O1 |
| InChI | InChI=1S/C6H10O4/c1-7-5-3-4-9-6(8-2)10-5/h3-6H,1-2H3 |
| InChIKey | FPWRASUKCNNOSR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |