C12H14O3 — CID 135056905
2-methoxy-5-(4-methoxyphenyl)-2,5-dihydrofuran (PubChem CID 135056905) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-methoxy-5-(4-methoxyphenyl)-2,5-dihydrofuran.
| Compound Name | 2-methoxy-5-(4-methoxyphenyl)-2,5-dihydrofuran |
|---|---|
| PubChem CID | 135056905 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-methoxy-5-(4-methoxyphenyl)-2,5-dihydrofuran |
| SMILES | COc1ccc(C2C=CC(OC)O2)cc1 |
| InChI | InChI=1S/C12H14O3/c1-13-10-5-3-9(4-6-10)11-7-8-12(14-2)15-11/h3-8,11-12H,1-2H3 |
| InChIKey | RMDZZJSTOHGHHT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|