C16H18O3 — CID 11379890
6-[(2S,5S)-5-(4-methoxyphenyl)-2,5-dihydrofuran-2-yl]-3,4-dihydro-2H-pyran (PubChem CID 11379890) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 6-[(2S,5S)-5-(4-methoxyphenyl)-2,5-dihydrofuran-2-yl]-3,4-dihydro-2H-pyran.
| Compound Name | 6-[(2S,5S)-5-(4-methoxyphenyl)-2,5-dihydrofuran-2-yl]-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 11379890 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 6-[(2S,5S)-5-(4-methoxyphenyl)-2,5-dihydrofuran-2-yl]-3,4-dihydro-2H-pyran |
| SMILES | COc1ccc([C@@H]2C=C[C@@H](C3=CCCCO3)O2)cc1 |
| InChI | InChI=1S/C16H18O3/c1-17-13-7-5-12(6-8-13)14-9-10-16(19-14)15-4-2-3-11-18-15/h4-10,14,16H,2-3,11H2,1H3/t14-,16-/m0/s1 |
| InChIKey | JHEMTNQCULWDQG-HOCLYGCPSA-N |
| XLogP | 3.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|