C16H22O2 — CID 134848928
(2S,5Z,8S)-8-(4-methoxyphenyl)-2,6-dimethyl-3,4,7,8-tetrahydro-2H-oxocine (PubChem CID 134848928) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (2S,5Z,8S)-8-(4-methoxyphenyl)-2,6-dimethyl-3,4,7,8-tetrahydro-2H-oxocine.
| Compound Name | (2S,5Z,8S)-8-(4-methoxyphenyl)-2,6-dimethyl-3,4,7,8-tetrahydro-2H-oxocine |
|---|---|
| PubChem CID | 134848928 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (2S,5Z,8S)-8-(4-methoxyphenyl)-2,6-dimethyl-3,4,7,8-tetrahydro-2H-oxocine |
| SMILES | COc1ccc([C@@H]2C/C(C)=C\CC[C@H](C)O2)cc1 |
| InChI | InChI=1S/C16H22O2/c1-12-5-4-6-13(2)18-16(11-12)14-7-9-15(17-3)10-8-14/h5,7-10,13,16H,4,6,11H2,1-3H3/b12-5-/t13-,16-/m0/s1 |
| InChIKey | JKTMPZSSAKVIGK-JZADBWSGSA-N |
| XLogP | 4.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|