C7H12O3 — CID 102509216
[(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]methanol (PubChem CID 102509216) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is [(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]methanol.
| Compound Name | [(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]methanol |
|---|---|
| PubChem CID | 102509216 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | [(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]methanol |
| SMILES | CO[C@@H]1C=CC[C@H](CO)O1 |
| InChI | InChI=1S/C7H12O3/c1-9-7-4-2-3-6(5-8)10-7/h2,4,6-8H,3,5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | USWZSVOYTUOFIM-RQJHMYQMSA-N |
| XLogP | 0.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|