C10H17NO3 — CID 121215909
2-[(6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]-N,N-dimethylacetamide (PubChem CID 121215909) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-[(6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 121215909 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 2-[(6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]-N,N-dimethylacetamide |
| SMILES | CO[C@@H]1C=CCC(CC(=O)N(C)C)O1 |
| InChI | InChI=1S/C10H17NO3/c1-11(2)9(12)7-8-5-4-6-10(13-3)14-8/h4,6,8,10H,5,7H2,1-3H3/t8?,10-/m0/s1 |
| InChIKey | OQDCOOLBHSDYEM-HTLJXXAVSA-N |
| XLogP | 0.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|