C8H12O4 — CID 11745085
methyl (2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-carboxylate (PubChem CID 11745085) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is methyl (2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-carboxylate.
| Compound Name | methyl (2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 11745085 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | methyl (2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-carboxylate |
| SMILES | COC(=O)[C@H]1CC=C[C@@H](OC)O1 |
| InChI | InChI=1S/C8H12O4/c1-10-7-5-3-4-6(12-7)8(9)11-2/h3,5-7H,4H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | BEPDBZBIHYPLTB-RQJHMYQMSA-N |
| XLogP | 0.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|