C7H10O3 — CID 10909671
methyl 3,4-dihydro-2H-pyran-2-carboxylate (PubChem CID 10909671) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is methyl 3,4-dihydro-2H-pyran-2-carboxylate.
| Compound Name | methyl 3,4-dihydro-2H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 10909671 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | methyl 3,4-dihydro-2H-pyran-2-carboxylate |
| SMILES | COC(=O)C1CCC=CO1 |
| InChI | InChI=1S/C7H10O3/c1-9-7(8)6-4-2-3-5-10-6/h3,5-6H,2,4H2,1H3 |
| InChIKey | CJTTXGOOWXOTSV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |