C8H13NO3 — CID 130711038
N-methoxy-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide (PubChem CID 130711038) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is N-methoxy-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide.
| Compound Name | N-methoxy-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide |
|---|---|
| PubChem CID | 130711038 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | N-methoxy-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide |
| SMILES | CON(C)C(=O)C1CCC=CO1 |
| InChI | InChI=1S/C8H13NO3/c1-9(11-2)8(10)7-5-3-4-6-12-7/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | OMKVJPMEWAFCMR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|