C6H10O3 — CID 14309521
(3S,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-ol (PubChem CID 14309521) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is (3S,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (3S,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 14309521 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (3S,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CO[C@@H]1C=C[C@H](O)CO1 |
| InChI | InChI=1S/C6H10O3/c1-8-6-3-2-5(7)4-9-6/h2-3,5-7H,4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | BMUNPNICWOAEEE-WDSKDSINSA-N |
| XLogP | -0.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|