C6H11N3O3S — CID 131075351
(2S,3R,4S,5S)-4-azido-2-methoxythiane-3,5-diol (PubChem CID 131075351) has the molecular formula C6H11N3O3S and a molecular weight of 205.24 g/mol. Its IUPAC name is (2S,3R,4S,5S)-4-azido-2-methoxythiane-3,5-diol.
| Compound Name | (2S,3R,4S,5S)-4-azido-2-methoxythiane-3,5-diol |
|---|---|
| PubChem CID | 131075351 |
| Molecular Formula | C6H11N3O3S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | (2S,3R,4S,5S)-4-azido-2-methoxythiane-3,5-diol |
| SMILES | CO[C@H]1SC[C@@H](O)[C@H](N=[N+]=[N-])[C@H]1O |
| InChI | InChI=1S/C6H11N3O3S/c1-12-6-5(11)4(8-9-7)3(10)2-13-6/h3-6,10-11H,2H2,1H3/t3-,4+,5-,6+/m1/s1 |
| InChIKey | STMJXWUFMCISSG-MOJAZDJTSA-N |
| XLogP | 0.11 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|