C12H12N4O2S2 — CID 101019285
4-[(2S,5S)-3-azido-4,5-dihydroxythian-2-yl]sulfanylbenzonitrile (PubChem CID 101019285) has the molecular formula C12H12N4O2S2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 4-[(2S,5S)-3-azido-4,5-dihydroxythian-2-yl]sulfanylbenzonitrile.
| Compound Name | 4-[(2S,5S)-3-azido-4,5-dihydroxythian-2-yl]sulfanylbenzonitrile |
|---|---|
| PubChem CID | 101019285 |
| Molecular Formula | C12H12N4O2S2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 4-[(2S,5S)-3-azido-4,5-dihydroxythian-2-yl]sulfanylbenzonitrile |
| SMILES | N#Cc1ccc(S[C@@H]2SC[C@@H](O)C(O)C2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C12H12N4O2S2/c13-5-7-1-3-8(4-2-7)20-12-10(15-16-14)11(18)9(17)6-19-12/h1-4,9-12,17-18H,6H2/t9-,10?,11?,12+/m1/s1 |
| InChIKey | GBJRGQFWYWDHKU-YYJSSNLHSA-N |
| XLogP | 2.12 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|