C14H16N2O4S — CID 11077706
N-(4-cyanophenyl)-2-[(2R,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]acetamide (PubChem CID 11077706) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-[(2R,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]acetamide.
| Compound Name | N-(4-cyanophenyl)-2-[(2R,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]acetamide |
|---|---|
| PubChem CID | 11077706 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-(4-cyanophenyl)-2-[(2R,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]acetamide |
| SMILES | N#Cc1ccc(NC(=O)C[C@H]2SC[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C14H16N2O4S/c15-6-8-1-3-9(4-2-8)16-12(18)5-11-14(20)13(19)10(17)7-21-11/h1-4,10-11,13-14,17,19-20H,5,7H2,(H,16,18)/t10-,11-,13+,14+/m1/s1 |
| InChIKey | UPDDJZXTFACQES-RFHZTLPTSA-N |
| XLogP | 0.08 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |