C17H24N3O+ — CID 9265471
[2-(4-cyanoanilino)-2-oxoethyl]-cyclooctylazanium (PubChem CID 9265471) has the molecular formula C17H24N3O+ and a molecular weight of 286.40 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl]-cyclooctylazanium.
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl]-cyclooctylazanium |
|---|---|
| PubChem CID | 9265471 |
| Molecular Formula | C17H24N3O+ |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl]-cyclooctylazanium |
| SMILES | N#Cc1ccc(NC(=O)C[NH2+]C2CCCCCCC2)cc1 |
| InChI | InChI=1S/C17H23N3O/c18-12-14-8-10-16(11-9-14)20-17(21)13-19-15-6-4-2-1-3-5-7-15/h8-11,15,19H,1-7,13H2,(H,20,21)/p+1 |
| InChIKey | RIDRHBVGVYFPHL-UHFFFAOYSA-O |
| XLogP | 2.17 |
| TPSA | 69.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |