C21H35N3O+2 — CID 8559059
cyclooctyl-[2-oxo-2-[4-(pyrrolidin-1-ium-1-ylmethyl)anilino]ethyl]azanium (PubChem CID 8559059) has the molecular formula C21H35N3O+2 and a molecular weight of 345.53 g/mol. Its IUPAC name is cyclooctyl-[2-oxo-2-[4-(pyrrolidin-1-ium-1-ylmethyl)anilino]ethyl]azanium.
| Compound Name | cyclooctyl-[2-oxo-2-[4-(pyrrolidin-1-ium-1-ylmethyl)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 8559059 |
| Molecular Formula | C21H35N3O+2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.28 |
| IUPAC Name | cyclooctyl-[2-oxo-2-[4-(pyrrolidin-1-ium-1-ylmethyl)anilino]ethyl]azanium |
| SMILES | O=C(C[NH2+]C1CCCCCCC1)Nc1ccc(C[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C21H33N3O/c25-21(16-22-19-8-4-2-1-3-5-9-19)23-20-12-10-18(11-13-20)17-24-14-6-7-15-24/h10-13,19,22H,1-9,14-17H2,(H,23,25)/p+2 |
| InChIKey | MPJUYYUNNUUVNT-UHFFFAOYSA-P |
| XLogP | 1.48 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |